C72H108O12 — CID 131883736
[3,6,7,10,11-penta(nonanoyloxy)triphenylen-2-yl] nonanoate (PubChem CID 131883736) has the molecular formula C72H108O12 and a molecular weight of 1165.64 g/mol. Its IUPAC name is [3,6,7,10,11-penta(nonanoyloxy)triphenylen-2-yl] nonanoate.
| Compound Name | [3,6,7,10,11-penta(nonanoyloxy)triphenylen-2-yl] nonanoate |
|---|---|
| PubChem CID | 131883736 |
| Molecular Formula | C72H108O12 |
| Molecular Weight | 1165.64 g/mol |
| Exact Mass | 1164.78 |
| IUPAC Name | [3,6,7,10,11-penta(nonanoyloxy)triphenylen-2-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)Oc1cc2c3cc(OC(=O)CCCCCCCC)c(OC(=O)CCCCCCCC)cc3c3cc(OC(=O)CCCCCCCC)c(OC(=O)CCCCCCCC)cc3c2cc1OC(=O)CCCCCCCC |
| InChI | InChI=1S/C72H108O12/c1-7-13-19-25-31-37-43-67(73)79-61-49-55-56(50-62(61)80-68(74)44-38-32-26-20-14-8-2)58-52-64(82-70(76)46-40-34-28-22-16-10-4)66(84-72(78)48-42-36-30-24-18-12-6)54-60(58)59-53-65(83-71(77)47-41-35-29-23-17-11-5)63(51-57(55)59)81-69(75)45-39-33-27-21-15-9-3/h49-54H,7-48H2,1-6H3 |
| InChIKey | OWMFDBWCFBDRIR-UHFFFAOYSA-N |
| XLogP | 21.08 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1165.64 |
| LogP ≤ 5 | 21.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|