C81H114O12 — CID 100955628
[5,14,15,23,24-penta(nonanoyloxy)-6-heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaenyl] nonanoate (PubChem CID 100955628) has the molecular formula C81H114O12 and a molecular weight of 1279.79 g/mol. Its IUPAC name is [5,14,15,23,24-penta(nonanoyloxy)-6-heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaenyl] nonanoate.
| Compound Name | [5,14,15,23,24-penta(nonanoyloxy)-6-heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaenyl] nonanoate |
|---|---|
| PubChem CID | 100955628 |
| Molecular Formula | C81H114O12 |
| Molecular Weight | 1279.79 g/mol |
| Exact Mass | 1278.83 |
| IUPAC Name | [5,14,15,23,24-penta(nonanoyloxy)-6-heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaenyl] nonanoate |
| SMILES | CCCCCCCCC(=O)Oc1cc2c(cc1OC(=O)CCCCCCCC)-c1c(c3c(c4c1Cc1cc(OC(=O)CCCCCCCC)c(OC(=O)CCCCCCCC)cc1-4)Cc1cc(OC(=O)CCCCCCCC)c(OC(=O)CCCCCCCC)cc1-3)C2 |
| InChI | InChI=1S/C81H114O12/c1-7-13-19-25-31-37-43-73(82)88-67-52-58-49-64-79(61(58)55-70(67)91-76(85)46-40-34-28-22-16-10-4)65-50-59-53-68(89-74(83)44-38-32-26-20-14-8-2)72(93-78(87)48-42-36-30-24-18-12-6)57-63(59)81(65)66-51-60-54-69(90-75(84)45-39-33-27-21-15-9-3)71(56-62(60)80(64)66)92-77(86)47-41-35-29-23-17-11-5/h52-57H,7-51H2,1-6H3 |
| InChIKey | SITWQRFEODYOEM-UHFFFAOYSA-N |
| XLogP | 22.34 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1279.79 |
| LogP ≤ 5 | 22.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|