C36H54O4 — CID 74763904
1,8-bis(3,5-ditert-butyl-4-hydroxyphenyl)octane-1,8-dione (PubChem CID 74763904) has the molecular formula C36H54O4 and a molecular weight of 550.82 g/mol. Its IUPAC name is 1,8-bis(3,5-ditert-butyl-4-hydroxyphenyl)octane-1,8-dione.
| Compound Name | 1,8-bis(3,5-ditert-butyl-4-hydroxyphenyl)octane-1,8-dione |
|---|---|
| PubChem CID | 74763904 |
| Molecular Formula | C36H54O4 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | 1,8-bis(3,5-ditert-butyl-4-hydroxyphenyl)octane-1,8-dione |
| SMILES | CC(C)(C)c1cc(C(=O)CCCCCCC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C36H54O4/c1-33(2,3)25-19-23(20-26(31(25)39)34(4,5)6)29(37)17-15-13-14-16-18-30(38)24-21-27(35(7,8)9)32(40)28(22-24)36(10,11)12/h19-22,39-40H,13-18H2,1-12H3 |
| InChIKey | NDIPANYIHGAFRU-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|