C18H28O2S — CID 21480176
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-ethylsulfanylethanone (PubChem CID 21480176) has the molecular formula C18H28O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-ethylsulfanylethanone.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-ethylsulfanylethanone |
|---|---|
| PubChem CID | 21480176 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-ethylsulfanylethanone |
| SMILES | CCSCC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H28O2S/c1-8-21-11-15(19)12-9-13(17(2,3)4)16(20)14(10-12)18(5,6)7/h9-10,20H,8,11H2,1-7H3 |
| InChIKey | UJADSSBUOXGILM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |