C16H23ClO2 — CID 14210977
2-chloro-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone (PubChem CID 14210977) has the molecular formula C16H23ClO2 and a molecular weight of 282.81 g/mol. Its IUPAC name is 2-chloro-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone.
| Compound Name | 2-chloro-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 14210977 |
| Molecular Formula | C16H23ClO2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-chloro-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
| SMILES | CC(C)(C)c1cc(C(=O)CCl)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C16H23ClO2/c1-15(2,3)11-7-10(13(18)9-17)8-12(14(11)19)16(4,5)6/h7-8,19H,9H2,1-6H3 |
| InChIKey | WJRFZHDXDOSUNC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|