C17H25ClO2 — CID 82265799
2-chloro-1-(3,5-ditert-butyl-4-methoxyphenyl)ethanone (PubChem CID 82265799) has the molecular formula C17H25ClO2 and a molecular weight of 296.84 g/mol. Its IUPAC name is 2-chloro-1-(3,5-ditert-butyl-4-methoxyphenyl)ethanone.
| Compound Name | 2-chloro-1-(3,5-ditert-butyl-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 82265799 |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-chloro-1-(3,5-ditert-butyl-4-methoxyphenyl)ethanone |
| SMILES | COc1c(C(C)(C)C)cc(C(=O)CCl)cc1C(C)(C)C |
| InChI | InChI=1S/C17H25ClO2/c1-16(2,3)12-8-11(14(19)10-18)9-13(15(12)20-7)17(4,5)6/h8-9H,10H2,1-7H3 |
| InChIKey | XJKQBMQUQJNUBF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|