C20H22O4S — CID 71471076
3-tert-butyl-2-methoxy-5-(2-phenylsulfanylacetyl)benzoic acid (PubChem CID 71471076) has the molecular formula C20H22O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is 3-tert-butyl-2-methoxy-5-(2-phenylsulfanylacetyl)benzoic acid.
| Compound Name | 3-tert-butyl-2-methoxy-5-(2-phenylsulfanylacetyl)benzoic acid |
|---|---|
| PubChem CID | 71471076 |
| Molecular Formula | C20H22O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-tert-butyl-2-methoxy-5-(2-phenylsulfanylacetyl)benzoic acid |
| SMILES | COc1c(C(=O)O)cc(C(=O)CSc2ccccc2)cc1C(C)(C)C |
| InChI | InChI=1S/C20H22O4S/c1-20(2,3)16-11-13(10-15(19(22)23)18(16)24-4)17(21)12-25-14-8-6-5-7-9-14/h5-11H,12H2,1-4H3,(H,22,23) |
| InChIKey | UOICTHVLGVQMDE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |