C17H18O4S — CID 93191547
2-phenylsulfanyl-1-(2,4,6-trimethoxyphenyl)ethanone (PubChem CID 93191547) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-phenylsulfanyl-1-(2,4,6-trimethoxyphenyl)ethanone.
| Compound Name | 2-phenylsulfanyl-1-(2,4,6-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 93191547 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-phenylsulfanyl-1-(2,4,6-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(OC)c(C(=O)CSc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C17H18O4S/c1-19-12-9-15(20-2)17(16(10-12)21-3)14(18)11-22-13-7-5-4-6-8-13/h4-10H,11H2,1-3H3 |
| InChIKey | MMZNVZPYSGLUQO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |