C16H14O4S — CID 82052354
2-methoxy-5-(2-phenylsulfanylacetyl)benzoic acid (PubChem CID 82052354) has the molecular formula C16H14O4S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-methoxy-5-(2-phenylsulfanylacetyl)benzoic acid.
| Compound Name | 2-methoxy-5-(2-phenylsulfanylacetyl)benzoic acid |
|---|---|
| PubChem CID | 82052354 |
| Molecular Formula | C16H14O4S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-methoxy-5-(2-phenylsulfanylacetyl)benzoic acid |
| SMILES | COc1ccc(C(=O)CSc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C16H14O4S/c1-20-15-8-7-11(9-13(15)16(18)19)14(17)10-21-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | LNNCHBANECRJTR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |