C22H37NO2 — CID 2187630
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(dipropylamino)ethanone (PubChem CID 2187630) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(dipropylamino)ethanone.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(dipropylamino)ethanone |
|---|---|
| PubChem CID | 2187630 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(dipropylamino)ethanone |
| SMILES | CCCN(CCC)CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H37NO2/c1-9-11-23(12-10-2)15-19(24)16-13-17(21(3,4)5)20(25)18(14-16)22(6,7)8/h13-14,25H,9-12,15H2,1-8H3 |
| InChIKey | KSAJFIJJDQAVCL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |