C18H27BrO2 — CID 86631892
2-bromo-1-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]ethanone (PubChem CID 86631892) has the molecular formula C18H27BrO2 and a molecular weight of 355.32 g/mol. Its IUPAC name is 2-bromo-1-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]ethanone.
| Compound Name | 2-bromo-1-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 86631892 |
| Molecular Formula | C18H27BrO2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-bromo-1-[4-hydroxy-3,5-bis(2-methylbutan-2-yl)phenyl]ethanone |
| SMILES | CCC(C)(C)c1cc(C(=O)CBr)cc(C(C)(C)CC)c1O |
| InChI | InChI=1S/C18H27BrO2/c1-7-17(3,4)13-9-12(15(20)11-19)10-14(16(13)21)18(5,6)8-2/h9-10,21H,7-8,11H2,1-6H3 |
| InChIKey | BNLSFSXPLUWATF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|