C31H46O3 — CID 88706173
(2,3-ditert-butylphenyl) 4-hydroxy-3,5-bis(2-methylbutan-2-yl)benzoate (PubChem CID 88706173) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is (2,3-ditert-butylphenyl) 4-hydroxy-3,5-bis(2-methylbutan-2-yl)benzoate.
| Compound Name | (2,3-ditert-butylphenyl) 4-hydroxy-3,5-bis(2-methylbutan-2-yl)benzoate |
|---|---|
| PubChem CID | 88706173 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | (2,3-ditert-butylphenyl) 4-hydroxy-3,5-bis(2-methylbutan-2-yl)benzoate |
| SMILES | CCC(C)(C)c1cc(C(=O)Oc2cccc(C(C)(C)C)c2C(C)(C)C)cc(C(C)(C)CC)c1O |
| InChI | InChI=1S/C31H46O3/c1-13-30(9,10)22-18-20(19-23(26(22)32)31(11,12)14-2)27(33)34-24-17-15-16-21(28(3,4)5)25(24)29(6,7)8/h15-19,32H,13-14H2,1-12H3 |
| InChIKey | FETNXEXORRDBHF-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|