C26H36O3 — CID 87421386
(2-pentylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 87421386) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is (2-pentylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | (2-pentylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 87421386 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (2-pentylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CCCCCc1ccccc1OC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H36O3/c1-8-9-10-13-18-14-11-12-15-22(18)29-24(28)19-16-20(25(2,3)4)23(27)21(17-19)26(5,6)7/h11-12,14-17,27H,8-10,13H2,1-7H3 |
| InChIKey | ZAZKNMDPBZNHBG-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|