C33H50O3 — CID 151109024
(2,3,4-tributylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 151109024) has the molecular formula C33H50O3 and a molecular weight of 494.76 g/mol. Its IUPAC name is (2,3,4-tributylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | (2,3,4-tributylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 151109024 |
| Molecular Formula | C33H50O3 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | (2,3,4-tributylphenyl) 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CCCCc1ccc(OC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(CCCC)c1CCCC |
| InChI | InChI=1S/C33H50O3/c1-10-13-16-23-19-20-29(26(18-15-12-3)25(23)17-14-11-2)36-31(35)24-21-27(32(4,5)6)30(34)28(22-24)33(7,8)9/h19-22,34H,10-18H2,1-9H3 |
| InChIKey | MPSLTOZPKSPGTJ-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|