C28H40O3 — CID 67180491
(2,3,4-tributylphenyl) (2,3,4-trimethylphenyl) carbonate (PubChem CID 67180491) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is (2,3,4-tributylphenyl) (2,3,4-trimethylphenyl) carbonate.
| Compound Name | (2,3,4-tributylphenyl) (2,3,4-trimethylphenyl) carbonate |
|---|---|
| PubChem CID | 67180491 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (2,3,4-tributylphenyl) (2,3,4-trimethylphenyl) carbonate |
| SMILES | CCCCc1ccc(OC(=O)Oc2ccc(C)c(C)c2C)c(CCCC)c1CCCC |
| InChI | InChI=1S/C28H40O3/c1-7-10-13-23-17-19-27(25(15-12-9-3)24(23)14-11-8-2)31-28(29)30-26-18-16-20(4)21(5)22(26)6/h16-19H,7-15H2,1-6H3 |
| InChIKey | ZKUBZLOZMZOQAG-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|