C24H42 — CID 175311687
1,2-dimethyl-3,4-dioctylbenzene (PubChem CID 175311687) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 1,2-dimethyl-3,4-dioctylbenzene.
| Compound Name | 1,2-dimethyl-3,4-dioctylbenzene |
|---|---|
| PubChem CID | 175311687 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 1,2-dimethyl-3,4-dioctylbenzene |
| SMILES | CCCCCCCCc1ccc(C)c(C)c1CCCCCCCC |
| InChI | InChI=1S/C24H42/c1-5-7-9-11-13-15-17-23-20-19-21(3)22(4)24(23)18-16-14-12-10-8-6-2/h19-20H,5-18H2,1-4H3 |
| InChIKey | PKTZIZWJYGOMGM-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|