C17H31NO — CID 67252247
azane;(3,4-dimethyl-2-octylphenyl)methanol (PubChem CID 67252247) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is azane;(3,4-dimethyl-2-octylphenyl)methanol.
| Compound Name | azane;(3,4-dimethyl-2-octylphenyl)methanol |
|---|---|
| PubChem CID | 67252247 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | azane;(3,4-dimethyl-2-octylphenyl)methanol |
| SMILES | CCCCCCCCc1c(CO)ccc(C)c1C.N |
| InChI | InChI=1S/C17H28O.H3N/c1-4-5-6-7-8-9-10-17-15(3)14(2)11-12-16(17)13-18;/h11-12,18H,4-10,13H2,1-3H3;1H3 |
| InChIKey | TUUKJKNTXUWNFB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|