C17H30ClN — CID 66778817
azane;1-(chloromethyl)-3,4-dimethyl-2-octylbenzene (PubChem CID 66778817) has the molecular formula C17H30ClN and a molecular weight of 283.89 g/mol. Its IUPAC name is azane;1-(chloromethyl)-3,4-dimethyl-2-octylbenzene.
| Compound Name | azane;1-(chloromethyl)-3,4-dimethyl-2-octylbenzene |
|---|---|
| PubChem CID | 66778817 |
| Molecular Formula | C17H30ClN |
| Molecular Weight | 283.89 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | azane;1-(chloromethyl)-3,4-dimethyl-2-octylbenzene |
| SMILES | CCCCCCCCc1c(CCl)ccc(C)c1C.N |
| InChI | InChI=1S/C17H27Cl.H3N/c1-4-5-6-7-8-9-10-17-15(3)14(2)11-12-16(17)13-18;/h11-12H,4-10,13H2,1-3H3;1H3 |
| InChIKey | YAWQWEYVYRWBPE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.89 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|