C16H26O — CID 141122420
2,3-dimethyl-6-octylphenol (PubChem CID 141122420) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 2,3-dimethyl-6-octylphenol.
| Compound Name | 2,3-dimethyl-6-octylphenol |
|---|---|
| PubChem CID | 141122420 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2,3-dimethyl-6-octylphenol |
| SMILES | CCCCCCCCc1ccc(C)c(C)c1O |
| InChI | InChI=1S/C16H26O/c1-4-5-6-7-8-9-10-15-12-11-13(2)14(3)16(15)17/h11-12,17H,4-10H2,1-3H3 |
| InChIKey | IYXMVKBAOXCTRU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|