C15H24MnO — CID 174911131
2,3-dibutyl-6-methylphenol;manganese (PubChem CID 174911131) has the molecular formula C15H24MnO and a molecular weight of 275.29 g/mol. Its IUPAC name is 2,3-dibutyl-6-methylphenol;manganese.
| Compound Name | 2,3-dibutyl-6-methylphenol;manganese |
|---|---|
| PubChem CID | 174911131 |
| Molecular Formula | C15H24MnO |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2,3-dibutyl-6-methylphenol;manganese |
| SMILES | CCCCc1ccc(C)c(O)c1CCCC.[Mn] |
| InChI | InChI=1S/C15H24O.Mn/c1-4-6-8-13-11-10-12(3)15(16)14(13)9-7-5-2;/h10-11,16H,4-9H2,1-3H3; |
| InChIKey | ZEAWZKWWWRCSGH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |