C14H24N2 — CID 18764845
3,4-dibutylbenzene-1,2-diamine (PubChem CID 18764845) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 3,4-dibutylbenzene-1,2-diamine.
| Compound Name | 3,4-dibutylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 18764845 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 3,4-dibutylbenzene-1,2-diamine |
| SMILES | CCCCc1ccc(N)c(N)c1CCCC |
| InChI | InChI=1S/C14H24N2/c1-3-5-7-11-9-10-13(15)14(16)12(11)8-6-4-2/h9-10H,3-8,15-16H2,1-2H3 |
| InChIKey | URMUVZVHUJIRJS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|