C12H23N3 — CID 22352094
azane;3,4-dipropylbenzene-1,2-diamine (PubChem CID 22352094) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is azane;3,4-dipropylbenzene-1,2-diamine.
| Compound Name | azane;3,4-dipropylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 22352094 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | azane;3,4-dipropylbenzene-1,2-diamine |
| SMILES | CCCc1ccc(N)c(N)c1CCC.N |
| InChI | InChI=1S/C12H20N2.H3N/c1-3-5-9-7-8-11(13)12(14)10(9)6-4-2;/h7-8H,3-6,13-14H2,1-2H3;1H3 |
| InChIKey | QAPDHVLIXJCHSB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|