About 2-ethyl-3-methyl-1,4-dipropylbenzene
2-ethyl-3-methyl-1,4-dipropylbenzene (PubChem CID 155697581) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is 2-ethyl-3-methyl-1,4-dipropylbenzene.
Molecular Properties
| Compound Name | 2-ethyl-3-methyl-1,4-dipropylbenzene |
| PubChem CID | 155697581 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 2-ethyl-3-methyl-1,4-dipropylbenzene |
| SMILES | CCCc1ccc(CCC)c(CC)c1C |
| InChI | InChI=1S/C15H24/c1-5-8-13-10-11-14(9-6-2)15(7-3)12(13)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | UQBJEKFXLGUJLA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethyl-3-methyl-1,4-dipropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methyl-1,4-dipropylbenzene?
The IUPAC name of 2-ethyl-3-methyl-1,4-dipropylbenzene (CID 155697581) is 2-ethyl-3-methyl-1,4-dipropylbenzene.
What is the SMILES notation for 2-ethyl-3-methyl-1,4-dipropylbenzene?
The canonical SMILES for 2-ethyl-3-methyl-1,4-dipropylbenzene is CCCc1ccc(CCC)c(CC)c1C.
What is the InChIKey of 2-ethyl-3-methyl-1,4-dipropylbenzene?
The InChIKey is UQBJEKFXLGUJLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24/c1-5-8-13-10-11-14(9-6-2)15(7-3)12(13)4/h10-11H,5-9H2,1-4H3.
What are the key properties of 2-ethyl-3-methyl-1,4-dipropylbenzene?
2-ethyl-3-methyl-1,4-dipropylbenzene has a molecular weight of 204.36 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methyl-1,4-dipropylbenzene is sourced from PubChem (CID 155697581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).