C19H23NO — CID 154351124
(2-amino-3,4-dipropylphenyl)-phenylmethanone (PubChem CID 154351124) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (2-amino-3,4-dipropylphenyl)-phenylmethanone.
| Compound Name | (2-amino-3,4-dipropylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 154351124 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (2-amino-3,4-dipropylphenyl)-phenylmethanone |
| SMILES | CCCc1ccc(C(=O)c2ccccc2)c(N)c1CCC |
| InChI | InChI=1S/C19H23NO/c1-3-8-14-12-13-17(18(20)16(14)9-4-2)19(21)15-10-6-5-7-11-15/h5-7,10-13H,3-4,8-9,20H2,1-2H3 |
| InChIKey | MWWZEMLDYVMSNQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|