C27H32N2O2 — CID 174453646
2-[4-[2-(3-amino-2,4-dipropylphenyl)ethyl]anilino]benzoic acid (PubChem CID 174453646) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[4-[2-(3-amino-2,4-dipropylphenyl)ethyl]anilino]benzoic acid.
| Compound Name | 2-[4-[2-(3-amino-2,4-dipropylphenyl)ethyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 174453646 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 2-[4-[2-(3-amino-2,4-dipropylphenyl)ethyl]anilino]benzoic acid |
| SMILES | CCCc1ccc(CCc2ccc(Nc3ccccc3C(=O)O)cc2)c(CCC)c1N |
| InChI | InChI=1S/C27H32N2O2/c1-3-7-21-16-15-20(23(8-4-2)26(21)28)14-11-19-12-17-22(18-13-19)29-25-10-6-5-9-24(25)27(30)31/h5-6,9-10,12-13,15-18,29H,3-4,7-8,11,14,28H2,1-2H3,(H,30,31) |
| InChIKey | BHXZDHXUMIXCLA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|