C20H23NO2 — CID 175499264
N-benzoyl-2,3-dipropylbenzamide (PubChem CID 175499264) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-benzoyl-2,3-dipropylbenzamide.
| Compound Name | N-benzoyl-2,3-dipropylbenzamide |
|---|---|
| PubChem CID | 175499264 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-benzoyl-2,3-dipropylbenzamide |
| SMILES | CCCc1cccc(C(=O)NC(=O)c2ccccc2)c1CCC |
| InChI | InChI=1S/C20H23NO2/c1-3-9-15-13-8-14-18(17(15)10-4-2)20(23)21-19(22)16-11-6-5-7-12-16/h5-8,11-14H,3-4,9-10H2,1-2H3,(H,21,22,23) |
| InChIKey | LUUBPLMZJSNPFS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|