C13H19Cl — CID 143014391
1-chloro-2-methyl-3,4-dipropylbenzene (PubChem CID 143014391) has the molecular formula C13H19Cl and a molecular weight of 210.75 g/mol. Its IUPAC name is 1-chloro-2-methyl-3,4-dipropylbenzene.
| Compound Name | 1-chloro-2-methyl-3,4-dipropylbenzene |
|---|---|
| PubChem CID | 143014391 |
| Molecular Formula | C13H19Cl |
| Molecular Weight | 210.75 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-chloro-2-methyl-3,4-dipropylbenzene |
| SMILES | CCCc1ccc(Cl)c(C)c1CCC |
| InChI | InChI=1S/C13H19Cl/c1-4-6-11-8-9-13(14)10(3)12(11)7-5-2/h8-9H,4-7H2,1-3H3 |
| InChIKey | PTSZNQVULLHYMF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |