About 2-(2,3-dipropylphenyl)aniline
2-(2,3-dipropylphenyl)aniline (PubChem CID 150874866) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-(2,3-dipropylphenyl)aniline.
Molecular Properties
| Compound Name | 2-(2,3-dipropylphenyl)aniline |
| PubChem CID | 150874866 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-(2,3-dipropylphenyl)aniline |
| SMILES | CCCc1cccc(-c2ccccc2N)c1CCC |
| InChI | InChI=1S/C18H23N/c1-3-8-14-10-7-12-16(15(14)9-4-2)17-11-5-6-13-18(17)19/h5-7,10-13H,3-4,8-9,19H2,1-2H3 |
| InChIKey | KUUDEMPVBVJEHK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dipropylphenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dipropylphenyl)aniline?
The IUPAC name of 2-(2,3-dipropylphenyl)aniline (CID 150874866) is 2-(2,3-dipropylphenyl)aniline.
What is the SMILES notation for 2-(2,3-dipropylphenyl)aniline?
The canonical SMILES for 2-(2,3-dipropylphenyl)aniline is CCCc1cccc(-c2ccccc2N)c1CCC.
What is the InChIKey of 2-(2,3-dipropylphenyl)aniline?
The InChIKey is KUUDEMPVBVJEHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N/c1-3-8-14-10-7-12-16(15(14)9-4-2)17-11-5-6-13-18(17)19/h5-7,10-13H,3-4,8-9,19H2,1-2H3.
What are the key properties of 2-(2,3-dipropylphenyl)aniline?
2-(2,3-dipropylphenyl)aniline has a molecular weight of 253.39 g/mol, XLogP of 4.84, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dipropylphenyl)aniline is sourced from PubChem (CID 150874866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).