About 3-iodo-2-propylaniline
3-iodo-2-propylaniline (PubChem CID 170306799) has the molecular formula C9H12IN
and a molecular weight of 261.11 g/mol. Its IUPAC name is 3-iodo-2-propylaniline.
Molecular Properties
| Compound Name | 3-iodo-2-propylaniline |
| PubChem CID | 170306799 |
| Molecular Formula | C9H12IN |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 3-iodo-2-propylaniline |
| SMILES | CCCc1c(N)cccc1I |
| InChI | InChI=1S/C9H12IN/c1-2-4-7-8(10)5-3-6-9(7)11/h3,5-6H,2,4,11H2,1H3 |
| InChIKey | LTQFAJUDOGMWFP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2-propylaniline?
The IUPAC name of 3-iodo-2-propylaniline (CID 170306799) is 3-iodo-2-propylaniline.
What is the SMILES notation for 3-iodo-2-propylaniline?
The canonical SMILES for 3-iodo-2-propylaniline is CCCc1c(N)cccc1I.
What is the InChIKey of 3-iodo-2-propylaniline?
The InChIKey is LTQFAJUDOGMWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12IN/c1-2-4-7-8(10)5-3-6-9(7)11/h3,5-6H,2,4,11H2,1H3.
What are the key properties of 3-iodo-2-propylaniline?
3-iodo-2-propylaniline has a molecular weight of 261.11 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2-propylaniline is sourced from PubChem (CID 170306799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).