About 2-butyl-3-chloroaniline
2-butyl-3-chloroaniline (PubChem CID 14012386) has the molecular formula C10H14ClN
and a molecular weight of 183.68 g/mol. Its IUPAC name is 2-butyl-3-chloroaniline.
Molecular Properties
| Compound Name | 2-butyl-3-chloroaniline |
| PubChem CID | 14012386 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-butyl-3-chloroaniline |
| SMILES | CCCCc1c(N)cccc1Cl |
| InChI | InChI=1S/C10H14ClN/c1-2-3-5-8-9(11)6-4-7-10(8)12/h4,6-7H,2-3,5,12H2,1H3 |
| InChIKey | IFLLHNMCIXRVEC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-3-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-chloroaniline?
The IUPAC name of 2-butyl-3-chloroaniline (CID 14012386) is 2-butyl-3-chloroaniline.
What is the SMILES notation for 2-butyl-3-chloroaniline?
The canonical SMILES for 2-butyl-3-chloroaniline is CCCCc1c(N)cccc1Cl.
What is the InChIKey of 2-butyl-3-chloroaniline?
The InChIKey is IFLLHNMCIXRVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN/c1-2-3-5-8-9(11)6-4-7-10(8)12/h4,6-7H,2-3,5,12H2,1H3.
What are the key properties of 2-butyl-3-chloroaniline?
2-butyl-3-chloroaniline has a molecular weight of 183.68 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-chloroaniline is sourced from PubChem (CID 14012386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).