C7H11N3 — CID 18451650
2-(aminomethyl)benzene-1,3-diamine (PubChem CID 18451650) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 2-(aminomethyl)benzene-1,3-diamine.
| Compound Name | 2-(aminomethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 18451650 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2-(aminomethyl)benzene-1,3-diamine |
| SMILES | NCc1c(N)cccc1N |
| InChI | InChI=1S/C7H11N3/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4,8-10H2 |
| InChIKey | BBMYBTGYJPGPFK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|