C22H30 — CID 174967419
1,2-dibutyl-3-(2,3-dimethylphenyl)benzene (PubChem CID 174967419) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene.
| Compound Name | 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene |
|---|---|
| PubChem CID | 174967419 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene |
| SMILES | CCCCc1cccc(-c2cccc(C)c2C)c1CCCC |
| InChI | InChI=1S/C22H30/c1-5-7-12-19-13-10-16-22(21(19)14-8-6-2)20-15-9-11-17(3)18(20)4/h9-11,13,15-16H,5-8,12,14H2,1-4H3 |
| InChIKey | IZLLECCWAPLGAV-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |