About 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene
1,2-dibutyl-3-(2,3-dimethylphenyl)benzene (PubChem CID 174967419) has the molecular formula C22H30
and a molecular weight of 294.48 g/mol. Its IUPAC name is 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene.
Molecular Properties
| Compound Name | 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene |
| PubChem CID | 174967419 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene |
| SMILES | CCCCc1cccc(-c2cccc(C)c2C)c1CCCC |
| InChI | InChI=1S/C22H30/c1-5-7-12-19-13-10-16-22(21(19)14-8-6-2)20-15-9-11-17(3)18(20)4/h9-11,13,15-16H,5-8,12,14H2,1-4H3 |
| InChIKey | IZLLECCWAPLGAV-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene?
The IUPAC name of 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene (CID 174967419) is 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene.
What is the SMILES notation for 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene?
The canonical SMILES for 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene is CCCCc1cccc(-c2cccc(C)c2C)c1CCCC.
What is the InChIKey of 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene?
The InChIKey is IZLLECCWAPLGAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30/c1-5-7-12-19-13-10-16-22(21(19)14-8-6-2)20-15-9-11-17(3)18(20)4/h9-11,13,15-16H,5-8,12,14H2,1-4H3.
What are the key properties of 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene?
1,2-dibutyl-3-(2,3-dimethylphenyl)benzene has a molecular weight of 294.48 g/mol, XLogP of 6.66, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibutyl-3-(2,3-dimethylphenyl)benzene is sourced from PubChem (CID 174967419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).