C18H23P — CID 151365985
(2,3-dipropylphenyl)-phenylphosphane (PubChem CID 151365985) has the molecular formula C18H23P and a molecular weight of 270.36 g/mol. Its IUPAC name is (2,3-dipropylphenyl)-phenylphosphane.
| Compound Name | (2,3-dipropylphenyl)-phenylphosphane |
|---|---|
| PubChem CID | 151365985 |
| Molecular Formula | C18H23P |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (2,3-dipropylphenyl)-phenylphosphane |
| SMILES | CCCc1cccc(Pc2ccccc2)c1CCC |
| InChI | InChI=1S/C18H23P/c1-3-9-15-11-8-14-18(17(15)10-4-2)19-16-12-6-5-7-13-16/h5-8,11-14,19H,3-4,9-10H2,1-2H3 |
| InChIKey | OPLCQLLPPJUZDM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|