C25H44 — CID 90707443
1,3-dioctyl-2-propylbenzene (PubChem CID 90707443) has the molecular formula C25H44 and a molecular weight of 344.63 g/mol. Its IUPAC name is 1,3-dioctyl-2-propylbenzene.
| Compound Name | 1,3-dioctyl-2-propylbenzene |
|---|---|
| PubChem CID | 90707443 |
| Molecular Formula | C25H44 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | 1,3-dioctyl-2-propylbenzene |
| SMILES | CCCCCCCCc1cccc(CCCCCCCC)c1CCC |
| InChI | InChI=1S/C25H44/c1-4-7-9-11-13-15-19-23-21-17-22-24(25(23)18-6-3)20-16-14-12-10-8-5-2/h17,21-22H,4-16,18-20H2,1-3H3 |
| InChIKey | RYCRGYHIXYYOSJ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|