C12H19NO — CID 134347282
2-amino-3,6-dipropylphenol (PubChem CID 134347282) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-amino-3,6-dipropylphenol.
| Compound Name | 2-amino-3,6-dipropylphenol |
|---|---|
| PubChem CID | 134347282 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-amino-3,6-dipropylphenol |
| SMILES | CCCc1ccc(CCC)c(O)c1N |
| InChI | InChI=1S/C12H19NO/c1-3-5-9-7-8-10(6-4-2)12(14)11(9)13/h7-8,14H,3-6,13H2,1-2H3 |
| InChIKey | BZPKMFRULMBDSI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|