C9H12N2O2 — CID 158015284
2-diazenyl-4-propylbenzene-1,3-diol (PubChem CID 158015284) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-diazenyl-4-propylbenzene-1,3-diol.
| Compound Name | 2-diazenyl-4-propylbenzene-1,3-diol |
|---|---|
| PubChem CID | 158015284 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-diazenyl-4-propylbenzene-1,3-diol |
| SMILES | [H]/N=N/c1c(O)ccc(CCC)c1O |
| InChI | InChI=1S/C9H12N2O2/c1-2-3-6-4-5-7(12)8(11-10)9(6)13/h4-5,10,12-13H,2-3H2,1H3/b11-10+ |
| InChIKey | YQDIFCGQUHOKHO-ZHACJKMWSA-N |
| XLogP | 2.71 |
| TPSA | 76.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|