About 2-diazenyl-3,4-bis(ethenyl)phenol;ethane
2-diazenyl-3,4-bis(ethenyl)phenol;ethane (PubChem CID 142860543) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-diazenyl-3,4-bis(ethenyl)phenol;ethane.
Molecular Properties
| Compound Name | 2-diazenyl-3,4-bis(ethenyl)phenol;ethane |
| PubChem CID | 142860543 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-diazenyl-3,4-bis(ethenyl)phenol;ethane |
| SMILES | CC.[H]/N=N/c1c(O)ccc(C=C)c1C=C |
| InChI | InChI=1S/C10H10N2O.C2H6/c1-3-7-5-6-9(13)10(12-11)8(7)4-2;1-2/h3-6,11,13H,1-2H2;1-2H3/b12-11+; |
| InChIKey | XCNIRFIDSVRBAJ-CALJPSDSSA-N |
| XLogP | 4.37 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-diazenyl-3,4-bis(ethenyl)phenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazenyl-3,4-bis(ethenyl)phenol;ethane?
The IUPAC name of 2-diazenyl-3,4-bis(ethenyl)phenol;ethane (CID 142860543) is 2-diazenyl-3,4-bis(ethenyl)phenol;ethane.
What is the SMILES notation for 2-diazenyl-3,4-bis(ethenyl)phenol;ethane?
The canonical SMILES for 2-diazenyl-3,4-bis(ethenyl)phenol;ethane is CC.[H]/N=N/c1c(O)ccc(C=C)c1C=C.
What is the InChIKey of 2-diazenyl-3,4-bis(ethenyl)phenol;ethane?
The InChIKey is XCNIRFIDSVRBAJ-CALJPSDSSA-N. The full InChI is InChI=1S/C10H10N2O.C2H6/c1-3-7-5-6-9(13)10(12-11)8(7)4-2;1-2/h3-6,11,13H,1-2H2;1-2H3/b12-11+;.
What are the key properties of 2-diazenyl-3,4-bis(ethenyl)phenol;ethane?
2-diazenyl-3,4-bis(ethenyl)phenol;ethane has a molecular weight of 204.27 g/mol, XLogP of 4.37, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazenyl-3,4-bis(ethenyl)phenol;ethane is sourced from PubChem (CID 142860543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).