C11H11Cl — CID 156751029
3-chloro-1,2-bis(ethenyl)-4-methylbenzene (PubChem CID 156751029) has the molecular formula C11H11Cl and a molecular weight of 178.66 g/mol. Its IUPAC name is 3-chloro-1,2-bis(ethenyl)-4-methylbenzene.
| Compound Name | 3-chloro-1,2-bis(ethenyl)-4-methylbenzene |
|---|---|
| PubChem CID | 156751029 |
| Molecular Formula | C11H11Cl |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 3-chloro-1,2-bis(ethenyl)-4-methylbenzene |
| SMILES | C=Cc1ccc(C)c(Cl)c1C=C |
| InChI | InChI=1S/C11H11Cl/c1-4-9-7-6-8(3)11(12)10(9)5-2/h4-7H,1-2H2,3H3 |
| InChIKey | MGGLWEJDLUIIJE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |