C22H18 — CID 143743555
3,4,5,6-tetrakis(ethenyl)phenanthrene (PubChem CID 143743555) has the molecular formula C22H18 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3,4,5,6-tetrakis(ethenyl)phenanthrene.
| Compound Name | 3,4,5,6-tetrakis(ethenyl)phenanthrene |
|---|---|
| PubChem CID | 143743555 |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3,4,5,6-tetrakis(ethenyl)phenanthrene |
| SMILES | C=Cc1ccc2ccc3ccc(C=C)c(C=C)c3c2c1C=C |
| InChI | InChI=1S/C22H18/c1-5-15-9-11-17-13-14-18-12-10-16(6-2)20(8-4)22(18)21(17)19(15)7-3/h5-14H,1-4H2 |
| InChIKey | IKSXBKWHOMQTKW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|