C20H28 — CID 145447193
1,2-bis(ethenyl)-6-methylnaphthalene;ethane;propane (PubChem CID 145447193) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-6-methylnaphthalene;ethane;propane.
| Compound Name | 1,2-bis(ethenyl)-6-methylnaphthalene;ethane;propane |
|---|---|
| PubChem CID | 145447193 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1,2-bis(ethenyl)-6-methylnaphthalene;ethane;propane |
| SMILES | C=Cc1ccc2cc(C)ccc2c1C=C.CC.CCC |
| InChI | InChI=1S/C15H14.C3H8.C2H6/c1-4-12-7-8-13-10-11(3)6-9-15(13)14(12)5-2;1-3-2;1-2/h4-10H,1-2H2,3H3;3H2,1-2H3;1-2H3 |
| InChIKey | YXWVPUCHEYAIIJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |