C15H14 — CID 59335501
1,3-bis(ethenyl)-7-methylnaphthalene (PubChem CID 59335501) has the molecular formula C15H14 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1,3-bis(ethenyl)-7-methylnaphthalene.
| Compound Name | 1,3-bis(ethenyl)-7-methylnaphthalene |
|---|---|
| PubChem CID | 59335501 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1,3-bis(ethenyl)-7-methylnaphthalene |
| SMILES | C=Cc1cc(C=C)c2cc(C)ccc2c1 |
| InChI | InChI=1S/C15H14/c1-4-12-9-13(5-2)15-8-11(3)6-7-14(15)10-12/h4-10H,1-2H2,3H3 |
| InChIKey | ZYRALMSFCFSECF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |