About 2,7-dimethylphenanthrene;ethane
2,7-dimethylphenanthrene;ethane (PubChem CID 91503011) has the molecular formula C22H32
and a molecular weight of 296.50 g/mol. Its IUPAC name is 2,7-dimethylphenanthrene;ethane.
Molecular Properties
| Compound Name | 2,7-dimethylphenanthrene;ethane |
| PubChem CID | 91503011 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 2,7-dimethylphenanthrene;ethane |
| SMILES | CC.CC.CC.Cc1ccc2c(ccc3cc(C)ccc32)c1 |
| InChI | InChI=1S/C16H14.3C2H6/c1-11-3-7-15-13(9-11)5-6-14-10-12(2)4-8-16(14)15;3*1-2/h3-10H,1-2H3;3*1-2H3 |
| InChIKey | ZMICWEUTRDHAQZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dimethylphenanthrene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylphenanthrene;ethane?
The IUPAC name of 2,7-dimethylphenanthrene;ethane (CID 91503011) is 2,7-dimethylphenanthrene;ethane.
What is the SMILES notation for 2,7-dimethylphenanthrene;ethane?
The canonical SMILES for 2,7-dimethylphenanthrene;ethane is CC.CC.CC.Cc1ccc2c(ccc3cc(C)ccc32)c1.
What is the InChIKey of 2,7-dimethylphenanthrene;ethane?
The InChIKey is ZMICWEUTRDHAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14.3C2H6/c1-11-3-7-15-13(9-11)5-6-14-10-12(2)4-8-16(14)15;3*1-2/h3-10H,1-2H3;3*1-2H3.
What are the key properties of 2,7-dimethylphenanthrene;ethane?
2,7-dimethylphenanthrene;ethane has a molecular weight of 296.50 g/mol, XLogP of 7.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylphenanthrene;ethane is sourced from PubChem (CID 91503011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).