C10H11N — CID 22666736
2,3-bis(ethenyl)aniline (PubChem CID 22666736) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 2,3-bis(ethenyl)aniline.
| Compound Name | 2,3-bis(ethenyl)aniline |
|---|---|
| PubChem CID | 22666736 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2,3-bis(ethenyl)aniline |
| SMILES | C=Cc1cccc(N)c1C=C |
| InChI | InChI=1S/C10H11N/c1-3-8-6-5-7-10(11)9(8)4-2/h3-7H,1-2,11H2 |
| InChIKey | AMWNXQRNGIITRG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|