C10H12N2 — CID 143316980
[2,3-bis(ethenyl)phenyl]hydrazine (PubChem CID 143316980) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is [2,3-bis(ethenyl)phenyl]hydrazine.
| Compound Name | [2,3-bis(ethenyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 143316980 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | [2,3-bis(ethenyl)phenyl]hydrazine |
| SMILES | C=Cc1cccc(NN)c1C=C |
| InChI | InChI=1S/C10H12N2/c1-3-8-6-5-7-10(12-11)9(8)4-2/h3-7,12H,1-2,11H2 |
| InChIKey | JSLJPPBKKNZLEW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|