C12H10Cl2 — CID 139664165
1-(2,2-dichloroethenyl)-2,3-bis(ethenyl)benzene (PubChem CID 139664165) has the molecular formula C12H10Cl2 and a molecular weight of 225.12 g/mol. Its IUPAC name is 1-(2,2-dichloroethenyl)-2,3-bis(ethenyl)benzene.
| Compound Name | 1-(2,2-dichloroethenyl)-2,3-bis(ethenyl)benzene |
|---|---|
| PubChem CID | 139664165 |
| Molecular Formula | C12H10Cl2 |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 1-(2,2-dichloroethenyl)-2,3-bis(ethenyl)benzene |
| SMILES | C=Cc1cccc(C=C(Cl)Cl)c1C=C |
| InChI | InChI=1S/C12H10Cl2/c1-3-9-6-5-7-10(8-12(13)14)11(9)4-2/h3-8H,1-2H2 |
| InChIKey | VXMDUJHJQSRFNY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |