C8H5Cl3 — CID 11298721
1-chloro-2-(2,2-dichloroethenyl)benzene (PubChem CID 11298721) has the molecular formula C8H5Cl3 and a molecular weight of 207.49 g/mol. Its IUPAC name is 1-chloro-2-(2,2-dichloroethenyl)benzene.
| Compound Name | 1-chloro-2-(2,2-dichloroethenyl)benzene |
|---|---|
| PubChem CID | 11298721 |
| Molecular Formula | C8H5Cl3 |
| Molecular Weight | 207.49 g/mol |
| Exact Mass | 205.95 |
| IUPAC Name | 1-chloro-2-(2,2-dichloroethenyl)benzene |
| SMILES | ClC(Cl)=Cc1ccccc1Cl |
| InChI | InChI=1S/C8H5Cl3/c9-7-4-2-1-3-6(7)5-8(10)11/h1-5H |
| InChIKey | HMOBYVTWFMPTON-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |