C13H14Cl2 — CID 53381482
1-chloro-2-[(1E)-2-chloro-3,4-dimethylpenta-1,3-dienyl]benzene (PubChem CID 53381482) has the molecular formula C13H14Cl2 and a molecular weight of 241.16 g/mol. Its IUPAC name is 1-chloro-2-[(1E)-2-chloro-3,4-dimethylpenta-1,3-dienyl]benzene.
| Compound Name | 1-chloro-2-[(1E)-2-chloro-3,4-dimethylpenta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 53381482 |
| Molecular Formula | C13H14Cl2 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-chloro-2-[(1E)-2-chloro-3,4-dimethylpenta-1,3-dienyl]benzene |
| SMILES | CC(C)=C(C)/C(Cl)=C\c1ccccc1Cl |
| InChI | InChI=1S/C13H14Cl2/c1-9(2)10(3)13(15)8-11-6-4-5-7-12(11)14/h4-8H,1-3H3/b13-8+ |
| InChIKey | QNUQIDVQKSHPLA-MDWZMJQESA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|