C12H13Cl — CID 84820223
1-chloro-2-[(1Z)-4-methylpenta-1,3-dienyl]benzene (PubChem CID 84820223) has the molecular formula C12H13Cl and a molecular weight of 192.69 g/mol. Its IUPAC name is 1-chloro-2-[(1Z)-4-methylpenta-1,3-dienyl]benzene.
| Compound Name | 1-chloro-2-[(1Z)-4-methylpenta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 84820223 |
| Molecular Formula | C12H13Cl |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-chloro-2-[(1Z)-4-methylpenta-1,3-dienyl]benzene |
| SMILES | CC(C)=C/C=C\c1ccccc1Cl |
| InChI | InChI=1S/C12H13Cl/c1-10(2)6-5-8-11-7-3-4-9-12(11)13/h3-9H,1-2H3/b8-5- |
| InChIKey | KTQPWVUIMOFGJL-YVMONPNESA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|