About N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride
N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride (PubChem CID 74054387) has the molecular formula C10H14Cl2N2O
and a molecular weight of 249.14 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride.
Molecular Properties
| Compound Name | N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride |
| PubChem CID | 74054387 |
| Molecular Formula | C10H14Cl2N2O |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride |
| SMILES | C/C(N)=N\C=Cc1ccccc1Cl.Cl.O |
| InChI | InChI=1S/C10H11ClN2.ClH.H2O/c1-8(12)13-7-6-9-4-2-3-5-10(9)11;;/h2-7H,1H3,(H2,12,13);1H;1H2 |
| InChIKey | QBKPCQPGDXEPJW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride?
The IUPAC name of N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride (CID 74054387) is N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride.
What is the SMILES notation for N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride?
The canonical SMILES for N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride is C/C(N)=N\C=Cc1ccccc1Cl.Cl.O.
What is the InChIKey of N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride?
The InChIKey is QBKPCQPGDXEPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2.ClH.H2O/c1-8(12)13-7-6-9-4-2-3-5-10(9)11;;/h2-7H,1H3,(H2,12,13);1H;1H2.
What are the key properties of N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride?
N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride has a molecular weight of 249.14 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-chlorophenyl)ethenyl]ethanimidamide;hydrate;hydrochloride is sourced from PubChem (CID 74054387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).