C18H14Cl2 — CID 59205815
1-chloro-2-[(1E,3E,5E)-6-(2-chlorophenyl)hexa-1,3,5-trienyl]benzene (PubChem CID 59205815) has the molecular formula C18H14Cl2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-chloro-2-[(1E,3E,5E)-6-(2-chlorophenyl)hexa-1,3,5-trienyl]benzene.
| Compound Name | 1-chloro-2-[(1E,3E,5E)-6-(2-chlorophenyl)hexa-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 59205815 |
| Molecular Formula | C18H14Cl2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 1-chloro-2-[(1E,3E,5E)-6-(2-chlorophenyl)hexa-1,3,5-trienyl]benzene |
| SMILES | Clc1ccccc1/C=C/C=C/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C18H14Cl2/c19-17-13-7-5-11-15(17)9-3-1-2-4-10-16-12-6-8-14-18(16)20/h1-14H/b2-1+,9-3+,10-4+ |
| InChIKey | TXWZEWGUSIDUJS-FOSXGVIDSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|